C9H2BrF6N — CID 119007564
4-bromo-2,5-bis(trifluoromethyl)benzonitrile (PubChem CID 119007564) has the molecular formula C9H2BrF6N and a molecular weight of 318.01 g/mol. Its IUPAC name is 4-bromo-2,5-bis(trifluoromethyl)benzonitrile.
| Compound Name | 4-bromo-2,5-bis(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 119007564 |
| Molecular Formula | C9H2BrF6N |
| Molecular Weight | 318.01 g/mol |
| Exact Mass | 316.93 |
| IUPAC Name | 4-bromo-2,5-bis(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1cc(C(F)(F)F)c(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C9H2BrF6N/c10-7-2-5(8(11,12)13)4(3-17)1-6(7)9(14,15)16/h1-2H |
| InChIKey | HOVNHDZWPLIPGW-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.01 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |