C8H2F5N — CID 71067450
2,4-difluoro-5-(trifluoromethyl)benzonitrile (PubChem CID 71067450) has the molecular formula C8H2F5N and a molecular weight of 207.10 g/mol. Its IUPAC name is 2,4-difluoro-5-(trifluoromethyl)benzonitrile.
| Compound Name | 2,4-difluoro-5-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 71067450 |
| Molecular Formula | C8H2F5N |
| Molecular Weight | 207.10 g/mol |
| Exact Mass | 207.01 |
| IUPAC Name | 2,4-difluoro-5-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1cc(C(F)(F)F)c(F)cc1F |
| InChI | InChI=1S/C8H2F5N/c9-6-2-7(10)5(8(11,12)13)1-4(6)3-14/h1-2H |
| InChIKey | SUNCYHLMIDQZRY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.10 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |