C12H11F2NO2 — CID 117350066
3-(5-cyano-2,4-difluorophenyl)-3-methylbutanoic acid (PubChem CID 117350066) has the molecular formula C12H11F2NO2 and a molecular weight of 239.22 g/mol. Its IUPAC name is 3-(5-cyano-2,4-difluorophenyl)-3-methylbutanoic acid.
| Compound Name | 3-(5-cyano-2,4-difluorophenyl)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 117350066 |
| Molecular Formula | C12H11F2NO2 |
| Molecular Weight | 239.22 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 3-(5-cyano-2,4-difluorophenyl)-3-methylbutanoic acid |
| SMILES | CC(C)(CC(=O)O)c1cc(C#N)c(F)cc1F |
| InChI | InChI=1S/C12H11F2NO2/c1-12(2,5-11(16)17)8-3-7(6-15)9(13)4-10(8)14/h3-4H,5H2,1-2H3,(H,16,17) |
| InChIKey | YAAUGFZXPBPPSQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.22 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |