C11H11F3O2 — CID 103304887
3-methyl-3-(2,4,5-trifluorophenyl)butanoic acid (PubChem CID 103304887) has the molecular formula C11H11F3O2 and a molecular weight of 232.20 g/mol. Its IUPAC name is 3-methyl-3-(2,4,5-trifluorophenyl)butanoic acid.
| Compound Name | 3-methyl-3-(2,4,5-trifluorophenyl)butanoic acid |
|---|---|
| PubChem CID | 103304887 |
| Molecular Formula | C11H11F3O2 |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 3-methyl-3-(2,4,5-trifluorophenyl)butanoic acid |
| SMILES | CC(C)(CC(=O)O)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C11H11F3O2/c1-11(2,5-10(15)16)6-3-8(13)9(14)4-7(6)12/h3-4H,5H2,1-2H3,(H,15,16) |
| InChIKey | SXEIPCQOANTKOG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|