C12H13F3O3 — CID 117409697
3-methyl-3-(3,4,5-trifluoro-2-methoxyphenyl)butanoic acid (PubChem CID 117409697) has the molecular formula C12H13F3O3 and a molecular weight of 262.23 g/mol. Its IUPAC name is 3-methyl-3-(3,4,5-trifluoro-2-methoxyphenyl)butanoic acid.
| Compound Name | 3-methyl-3-(3,4,5-trifluoro-2-methoxyphenyl)butanoic acid |
|---|---|
| PubChem CID | 117409697 |
| Molecular Formula | C12H13F3O3 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 3-methyl-3-(3,4,5-trifluoro-2-methoxyphenyl)butanoic acid |
| SMILES | COc1c(C(C)(C)CC(=O)O)cc(F)c(F)c1F |
| InChI | InChI=1S/C12H13F3O3/c1-12(2,5-8(16)17)6-4-7(13)9(14)10(15)11(6)18-3/h4H,5H2,1-3H3,(H,16,17) |
| InChIKey | ZQXJNJHRAMAWHV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|