C12H14ClFO4 — CID 117443317
3-(2-chloro-3-fluoro-5-hydroxy-6-methoxyphenyl)-3-methylbutanoic acid (PubChem CID 117443317) has the molecular formula C12H14ClFO4 and a molecular weight of 276.69 g/mol. Its IUPAC name is 3-(2-chloro-3-fluoro-5-hydroxy-6-methoxyphenyl)-3-methylbutanoic acid.
| Compound Name | 3-(2-chloro-3-fluoro-5-hydroxy-6-methoxyphenyl)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 117443317 |
| Molecular Formula | C12H14ClFO4 |
| Molecular Weight | 276.69 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 3-(2-chloro-3-fluoro-5-hydroxy-6-methoxyphenyl)-3-methylbutanoic acid |
| SMILES | COc1c(O)cc(F)c(Cl)c1C(C)(C)CC(=O)O |
| InChI | InChI=1S/C12H14ClFO4/c1-12(2,5-8(16)17)9-10(13)6(14)4-7(15)11(9)18-3/h4,15H,5H2,1-3H3,(H,16,17) |
| InChIKey | NTKAWKSTXNMDTG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.69 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |