C11H9ClF4O2 — CID 115113034
3-(4-chloro-2,3,5,6-tetrafluorophenyl)-3-methylbutanoic acid (PubChem CID 115113034) has the molecular formula C11H9ClF4O2 and a molecular weight of 284.64 g/mol. Its IUPAC name is 3-(4-chloro-2,3,5,6-tetrafluorophenyl)-3-methylbutanoic acid.
| Compound Name | 3-(4-chloro-2,3,5,6-tetrafluorophenyl)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 115113034 |
| Molecular Formula | C11H9ClF4O2 |
| Molecular Weight | 284.64 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 3-(4-chloro-2,3,5,6-tetrafluorophenyl)-3-methylbutanoic acid |
| SMILES | CC(C)(CC(=O)O)c1c(F)c(F)c(Cl)c(F)c1F |
| InChI | InChI=1S/C11H9ClF4O2/c1-11(2,3-4(17)18)5-7(13)9(15)6(12)10(16)8(5)14/h3H2,1-2H3,(H,17,18) |
| InChIKey | MZWJHOUQDZHZIV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.64 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|