C11H11BrClFO2 — CID 117494264
3-(6-bromo-3-chloro-2-fluorophenyl)-3-methylbutanoic acid (PubChem CID 117494264) has the molecular formula C11H11BrClFO2 and a molecular weight of 309.56 g/mol. Its IUPAC name is 3-(6-bromo-3-chloro-2-fluorophenyl)-3-methylbutanoic acid.
| Compound Name | 3-(6-bromo-3-chloro-2-fluorophenyl)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 117494264 |
| Molecular Formula | C11H11BrClFO2 |
| Molecular Weight | 309.56 g/mol |
| Exact Mass | 307.96 |
| IUPAC Name | 3-(6-bromo-3-chloro-2-fluorophenyl)-3-methylbutanoic acid |
| SMILES | CC(C)(CC(=O)O)c1c(Br)ccc(Cl)c1F |
| InChI | InChI=1S/C11H11BrClFO2/c1-11(2,5-8(15)16)9-6(12)3-4-7(13)10(9)14/h3-4H,5H2,1-2H3,(H,15,16) |
| InChIKey | WMSGBGLLTMWRIJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.56 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|