C11H11ClF2O2 — CID 117374834
3-(2-chloro-3,4-difluorophenyl)-3-methylbutanoic acid (PubChem CID 117374834) has the molecular formula C11H11ClF2O2 and a molecular weight of 248.66 g/mol. Its IUPAC name is 3-(2-chloro-3,4-difluorophenyl)-3-methylbutanoic acid.
| Compound Name | 3-(2-chloro-3,4-difluorophenyl)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 117374834 |
| Molecular Formula | C11H11ClF2O2 |
| Molecular Weight | 248.66 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 3-(2-chloro-3,4-difluorophenyl)-3-methylbutanoic acid |
| SMILES | CC(C)(CC(=O)O)c1ccc(F)c(F)c1Cl |
| InChI | InChI=1S/C11H11ClF2O2/c1-11(2,5-8(15)16)6-3-4-7(13)10(14)9(6)12/h3-4H,5H2,1-2H3,(H,15,16) |
| InChIKey | QACUKEQUEOEZNO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.66 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|