C12H13FO4 — CID 117352764
3-(4-fluoro-1,3-benzodioxol-5-yl)-3-methylbutanoic acid (PubChem CID 117352764) has the molecular formula C12H13FO4 and a molecular weight of 240.23 g/mol. Its IUPAC name is 3-(4-fluoro-1,3-benzodioxol-5-yl)-3-methylbutanoic acid.
| Compound Name | 3-(4-fluoro-1,3-benzodioxol-5-yl)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 117352764 |
| Molecular Formula | C12H13FO4 |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 3-(4-fluoro-1,3-benzodioxol-5-yl)-3-methylbutanoic acid |
| SMILES | CC(C)(CC(=O)O)c1ccc2c(c1F)OCO2 |
| InChI | InChI=1S/C12H13FO4/c1-12(2,5-9(14)15)7-3-4-8-11(10(7)13)17-6-16-8/h3-4H,5-6H2,1-2H3,(H,14,15) |
| InChIKey | CKBARQTXVFYLBU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |