C11H12BrFO4 — CID 117492121
3-(6-bromo-4-fluoro-2,3-dihydroxyphenyl)-3-methylbutanoic acid (PubChem CID 117492121) has the molecular formula C11H12BrFO4 and a molecular weight of 307.12 g/mol. Its IUPAC name is 3-(6-bromo-4-fluoro-2,3-dihydroxyphenyl)-3-methylbutanoic acid.
| Compound Name | 3-(6-bromo-4-fluoro-2,3-dihydroxyphenyl)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 117492121 |
| Molecular Formula | C11H12BrFO4 |
| Molecular Weight | 307.12 g/mol |
| Exact Mass | 305.99 |
| IUPAC Name | 3-(6-bromo-4-fluoro-2,3-dihydroxyphenyl)-3-methylbutanoic acid |
| SMILES | CC(C)(CC(=O)O)c1c(Br)cc(F)c(O)c1O |
| InChI | InChI=1S/C11H12BrFO4/c1-11(2,4-7(14)15)8-5(12)3-6(13)9(16)10(8)17/h3,16-17H,4H2,1-2H3,(H,14,15) |
| InChIKey | BOPPMUGGLWNYRZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.12 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|