About 4-[4-cyano-2-(trifluoromethyl)phenyl]-2,5-difluorobenzonitrile
4-[4-cyano-2-(trifluoromethyl)phenyl]-2,5-difluorobenzonitrile (PubChem CID 142414168) has the molecular formula C15H5F5N2
and a molecular weight of 308.21 g/mol. Its IUPAC name is 4-[4-cyano-2-(trifluoromethyl)phenyl]-2,5-difluorobenzonitrile.
Molecular Properties
| Compound Name | 4-[4-cyano-2-(trifluoromethyl)phenyl]-2,5-difluorobenzonitrile |
| PubChem CID | 142414168 |
| Molecular Formula | C15H5F5N2 |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 4-[4-cyano-2-(trifluoromethyl)phenyl]-2,5-difluorobenzonitrile |
| SMILES | N#Cc1ccc(-c2cc(F)c(C#N)cc2F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H5F5N2/c16-13-5-11(14(17)4-9(13)7-22)10-2-1-8(6-21)3-12(10)15(18,19)20/h1-5H |
| InChIKey | WQLMPXFMYVHCHN-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[4-cyano-2-(trifluoromethyl)phenyl]-2,5-difluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-cyano-2-(trifluoromethyl)phenyl]-2,5-difluorobenzonitrile?
The IUPAC name of 4-[4-cyano-2-(trifluoromethyl)phenyl]-2,5-difluorobenzonitrile (CID 142414168) is 4-[4-cyano-2-(trifluoromethyl)phenyl]-2,5-difluorobenzonitrile.
What is the SMILES notation for 4-[4-cyano-2-(trifluoromethyl)phenyl]-2,5-difluorobenzonitrile?
The canonical SMILES for 4-[4-cyano-2-(trifluoromethyl)phenyl]-2,5-difluorobenzonitrile is N#Cc1ccc(-c2cc(F)c(C#N)cc2F)c(C(F)(F)F)c1.
What is the InChIKey of 4-[4-cyano-2-(trifluoromethyl)phenyl]-2,5-difluorobenzonitrile?
The InChIKey is WQLMPXFMYVHCHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H5F5N2/c16-13-5-11(14(17)4-9(13)7-22)10-2-1-8(6-21)3-12(10)15(18,19)20/h1-5H.
What are the key properties of 4-[4-cyano-2-(trifluoromethyl)phenyl]-2,5-difluorobenzonitrile?
4-[4-cyano-2-(trifluoromethyl)phenyl]-2,5-difluorobenzonitrile has a molecular weight of 308.21 g/mol, XLogP of 4.39, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-cyano-2-(trifluoromethyl)phenyl]-2,5-difluorobenzonitrile is sourced from PubChem (CID 142414168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).