C28H14F3N3 — CID 144950220
[6-imino-5-phenyl-11-(trifluoromethyl)indeno[1,2-b]fluoren-12-ylidene]cyanamide (PubChem CID 144950220) has the molecular formula C28H14F3N3 and a molecular weight of 449.44 g/mol. Its IUPAC name is [6-imino-5-phenyl-11-(trifluoromethyl)indeno[1,2-b]fluoren-12-ylidene]cyanamide.
| Compound Name | [6-imino-5-phenyl-11-(trifluoromethyl)indeno[1,2-b]fluoren-12-ylidene]cyanamide |
|---|---|
| PubChem CID | 144950220 |
| Molecular Formula | C28H14F3N3 |
| Molecular Weight | 449.44 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | [6-imino-5-phenyl-11-(trifluoromethyl)indeno[1,2-b]fluoren-12-ylidene]cyanamide |
| SMILES | [H]/N=c1\c2ccccc2c2c(C(F)(F)F)c3/c(=N/C#N)c4ccccc4c3c(-c3ccccc3)c12 |
| InChI | InChI=1S/C28H14F3N3/c29-28(30,31)25-22-16-10-4-6-12-18(16)26(33)23(22)20(15-8-2-1-3-9-15)21-17-11-5-7-13-19(17)27(24(21)25)34-14-32/h1-13,33H/b33-26+,34-27+ |
| InChIKey | NMWSUNJQOCSWPS-HLZBKTFKSA-N |
| XLogP | 6.72 |
| TPSA | 60.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.44 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|