C26H14N4 — CID 163645506
(2-cyanoimino-1,3-diphenylcyclopenta[a]inden-4-ylidene)cyanamide (PubChem CID 163645506) has the molecular formula C26H14N4 and a molecular weight of 382.43 g/mol. Its IUPAC name is (2-cyanoimino-1,3-diphenylcyclopenta[a]inden-4-ylidene)cyanamide.
| Compound Name | (2-cyanoimino-1,3-diphenylcyclopenta[a]inden-4-ylidene)cyanamide |
|---|---|
| PubChem CID | 163645506 |
| Molecular Formula | C26H14N4 |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | (2-cyanoimino-1,3-diphenylcyclopenta[a]inden-4-ylidene)cyanamide |
| SMILES | N#C/N=c1\c(-c2ccccc2)c2/c(=N/C#N)c3ccccc3c-2c1-c1ccccc1 |
| InChI | InChI=1S/C26H14N4/c27-15-29-25-20-14-8-7-13-19(20)23-21(17-9-3-1-4-10-17)26(30-16-28)22(24(23)25)18-11-5-2-6-12-18/h1-14H/b29-25+,30-26- |
| InChIKey | IHWFCIDJKSHGCM-LQJPZNDESA-N |
| XLogP | 4.92 |
| TPSA | 72.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|