C34H18N4S2 — CID 139501646
[10-cyanoimino-2,8-bis(phenylsulfanyl)indeno[2,1-b]fluoren-12-ylidene]cyanamide (PubChem CID 139501646) has the molecular formula C34H18N4S2 and a molecular weight of 546.68 g/mol. Its IUPAC name is [10-cyanoimino-2,8-bis(phenylsulfanyl)indeno[2,1-b]fluoren-12-ylidene]cyanamide.
| Compound Name | [10-cyanoimino-2,8-bis(phenylsulfanyl)indeno[2,1-b]fluoren-12-ylidene]cyanamide |
|---|---|
| PubChem CID | 139501646 |
| Molecular Formula | C34H18N4S2 |
| Molecular Weight | 546.68 g/mol |
| Exact Mass | 546.10 |
| IUPAC Name | [10-cyanoimino-2,8-bis(phenylsulfanyl)indeno[2,1-b]fluoren-12-ylidene]cyanamide |
| SMILES | N#C/N=c1\c2cc(Sc3ccccc3)ccc2c2cc3c(cc12)/c(=N/C#N)c1cc(Sc2ccccc2)ccc13 |
| InChI | InChI=1S/C34H18N4S2/c35-19-37-33-29-15-23(39-21-7-3-1-4-8-21)11-13-25(29)27-17-28-26-14-12-24(40-22-9-5-2-6-10-22)16-30(26)34(38-20-36)32(28)18-31(27)33/h1-18H/b37-33+,38-34+ |
| InChIKey | PODWORPPKIMUIJ-YEQLPCBTSA-N |
| XLogP | 8.24 |
| TPSA | 72.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.68 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|