About 5-[3,5-bis(trifluoromethyl)phenyl]-3-(trifluoromethyl)benzene-1,2-dicarbonitrile
5-[3,5-bis(trifluoromethyl)phenyl]-3-(trifluoromethyl)benzene-1,2-dicarbonitrile (PubChem CID 169121716) has the molecular formula C17H5F9N2
and a molecular weight of 408.22 g/mol. Its IUPAC name is 5-[3,5-bis(trifluoromethyl)phenyl]-3-(trifluoromethyl)benzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 5-[3,5-bis(trifluoromethyl)phenyl]-3-(trifluoromethyl)benzene-1,2-dicarbonitrile |
| PubChem CID | 169121716 |
| Molecular Formula | C17H5F9N2 |
| Molecular Weight | 408.22 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | 5-[3,5-bis(trifluoromethyl)phenyl]-3-(trifluoromethyl)benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1cc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(C(F)(F)F)c1C#N |
| InChI | InChI=1S/C17H5F9N2/c18-15(19,20)11-2-9(3-12(5-11)16(21,22)23)8-1-10(6-27)13(7-28)14(4-8)17(24,25)26/h1-5H |
| InChIKey | YUTULTLOGYZZHI-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.22 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[3,5-bis(trifluoromethyl)phenyl]-3-(trifluoromethyl)benzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3,5-bis(trifluoromethyl)phenyl]-3-(trifluoromethyl)benzene-1,2-dicarbonitrile?
The IUPAC name of 5-[3,5-bis(trifluoromethyl)phenyl]-3-(trifluoromethyl)benzene-1,2-dicarbonitrile (CID 169121716) is 5-[3,5-bis(trifluoromethyl)phenyl]-3-(trifluoromethyl)benzene-1,2-dicarbonitrile.
What is the SMILES notation for 5-[3,5-bis(trifluoromethyl)phenyl]-3-(trifluoromethyl)benzene-1,2-dicarbonitrile?
The canonical SMILES for 5-[3,5-bis(trifluoromethyl)phenyl]-3-(trifluoromethyl)benzene-1,2-dicarbonitrile is N#Cc1cc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(C(F)(F)F)c1C#N.
What is the InChIKey of 5-[3,5-bis(trifluoromethyl)phenyl]-3-(trifluoromethyl)benzene-1,2-dicarbonitrile?
The InChIKey is YUTULTLOGYZZHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H5F9N2/c18-15(19,20)11-2-9(3-12(5-11)16(21,22)23)8-1-10(6-27)13(7-28)14(4-8)17(24,25)26/h1-5H.
What are the key properties of 5-[3,5-bis(trifluoromethyl)phenyl]-3-(trifluoromethyl)benzene-1,2-dicarbonitrile?
5-[3,5-bis(trifluoromethyl)phenyl]-3-(trifluoromethyl)benzene-1,2-dicarbonitrile has a molecular weight of 408.22 g/mol, XLogP of 6.15, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3,5-bis(trifluoromethyl)phenyl]-3-(trifluoromethyl)benzene-1,2-dicarbonitrile is sourced from PubChem (CID 169121716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).