C11H4F6N2 — CID 119002586
2-(cyanomethyl)-3,5-bis(trifluoromethyl)benzonitrile (PubChem CID 119002586) has the molecular formula C11H4F6N2 and a molecular weight of 278.16 g/mol. Its IUPAC name is 2-(cyanomethyl)-3,5-bis(trifluoromethyl)benzonitrile.
| Compound Name | 2-(cyanomethyl)-3,5-bis(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 119002586 |
| Molecular Formula | C11H4F6N2 |
| Molecular Weight | 278.16 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 2-(cyanomethyl)-3,5-bis(trifluoromethyl)benzonitrile |
| SMILES | N#CCc1c(C#N)cc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C11H4F6N2/c12-10(13,14)7-3-6(5-19)8(1-2-18)9(4-7)11(15,16)17/h3-4H,1H2 |
| InChIKey | OWBCNPAJEOJKQY-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.16 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |