C10H6F6N2 — CID 134623563
4-(aminomethyl)-2,6-bis(trifluoromethyl)benzonitrile (PubChem CID 134623563) has the molecular formula C10H6F6N2 and a molecular weight of 268.16 g/mol. Its IUPAC name is 4-(aminomethyl)-2,6-bis(trifluoromethyl)benzonitrile.
| Compound Name | 4-(aminomethyl)-2,6-bis(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 134623563 |
| Molecular Formula | C10H6F6N2 |
| Molecular Weight | 268.16 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 4-(aminomethyl)-2,6-bis(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1c(C(F)(F)F)cc(CN)cc1C(F)(F)F |
| InChI | InChI=1S/C10H6F6N2/c11-9(12,13)7-1-5(3-17)2-8(6(7)4-18)10(14,15)16/h1-2H,3,17H2 |
| InChIKey | SWHXXEGLODFXFV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.16 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |