C11H11F6N — CID 135742788
[4-ethyl-3,5-bis(trifluoromethyl)phenyl]methanamine (PubChem CID 135742788) has the molecular formula C11H11F6N and a molecular weight of 271.20 g/mol. Its IUPAC name is [4-ethyl-3,5-bis(trifluoromethyl)phenyl]methanamine.
| Compound Name | [4-ethyl-3,5-bis(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 135742788 |
| Molecular Formula | C11H11F6N |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | [4-ethyl-3,5-bis(trifluoromethyl)phenyl]methanamine |
| SMILES | CCc1c(C(F)(F)F)cc(CN)cc1C(F)(F)F |
| InChI | InChI=1S/C11H11F6N/c1-2-7-8(10(12,13)14)3-6(5-18)4-9(7)11(15,16)17/h3-4H,2,5,18H2,1H3 |
| InChIKey | XKSLELOZXQQFIH-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |