C11H9ClF6 — CID 135742809
1-(chloromethyl)-2-ethyl-3,5-bis(trifluoromethyl)benzene (PubChem CID 135742809) has the molecular formula C11H9ClF6 and a molecular weight of 290.63 g/mol. Its IUPAC name is 1-(chloromethyl)-2-ethyl-3,5-bis(trifluoromethyl)benzene.
| Compound Name | 1-(chloromethyl)-2-ethyl-3,5-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 135742809 |
| Molecular Formula | C11H9ClF6 |
| Molecular Weight | 290.63 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 1-(chloromethyl)-2-ethyl-3,5-bis(trifluoromethyl)benzene |
| SMILES | CCc1c(CCl)cc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C11H9ClF6/c1-2-8-6(5-12)3-7(10(13,14)15)4-9(8)11(16,17)18/h3-4H,2,5H2,1H3 |
| InChIKey | OVGLJMWFKLFDCF-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.63 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|