C12H8F6O3 — CID 71651332
2-[2-ethyl-3,5-bis(trifluoromethyl)phenyl]-2-oxoacetic acid (PubChem CID 71651332) has the molecular formula C12H8F6O3 and a molecular weight of 314.18 g/mol. Its IUPAC name is 2-[2-ethyl-3,5-bis(trifluoromethyl)phenyl]-2-oxoacetic acid.
| Compound Name | 2-[2-ethyl-3,5-bis(trifluoromethyl)phenyl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 71651332 |
| Molecular Formula | C12H8F6O3 |
| Molecular Weight | 314.18 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 2-[2-ethyl-3,5-bis(trifluoromethyl)phenyl]-2-oxoacetic acid |
| SMILES | CCc1c(C(=O)C(=O)O)cc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C12H8F6O3/c1-2-6-7(9(19)10(20)21)3-5(11(13,14)15)4-8(6)12(16,17)18/h3-4H,2H2,1H3,(H,20,21) |
| InChIKey | IBPMRSUHOAMSFZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.18 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|