C13H12F9N — CID 139965873
N-methyl-1-[2,4,6-tris(trifluoromethyl)phenyl]propan-1-amine (PubChem CID 139965873) has the molecular formula C13H12F9N and a molecular weight of 353.23 g/mol. Its IUPAC name is N-methyl-1-[2,4,6-tris(trifluoromethyl)phenyl]propan-1-amine.
| Compound Name | N-methyl-1-[2,4,6-tris(trifluoromethyl)phenyl]propan-1-amine |
|---|---|
| PubChem CID | 139965873 |
| Molecular Formula | C13H12F9N |
| Molecular Weight | 353.23 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | N-methyl-1-[2,4,6-tris(trifluoromethyl)phenyl]propan-1-amine |
| SMILES | CCC(NC)c1c(C(F)(F)F)cc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C13H12F9N/c1-3-9(23-2)10-7(12(17,18)19)4-6(11(14,15)16)5-8(10)13(20,21)22/h4-5,9,23H,3H2,1-2H3 |
| InChIKey | FDFWTPZNZOURSH-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.23 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |