C15H21BrF3N — CID 105028352
1-[2-bromo-5-(trifluoromethyl)phenyl]-3-ethyl-N-methylpentan-1-amine (PubChem CID 105028352) has the molecular formula C15H21BrF3N and a molecular weight of 352.24 g/mol. Its IUPAC name is 1-[2-bromo-5-(trifluoromethyl)phenyl]-3-ethyl-N-methylpentan-1-amine.
| Compound Name | 1-[2-bromo-5-(trifluoromethyl)phenyl]-3-ethyl-N-methylpentan-1-amine |
|---|---|
| PubChem CID | 105028352 |
| Molecular Formula | C15H21BrF3N |
| Molecular Weight | 352.24 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 1-[2-bromo-5-(trifluoromethyl)phenyl]-3-ethyl-N-methylpentan-1-amine |
| SMILES | CCC(CC)CC(NC)c1cc(C(F)(F)F)ccc1Br |
| InChI | InChI=1S/C15H21BrF3N/c1-4-10(5-2)8-14(20-3)12-9-11(15(17,18)19)6-7-13(12)16/h6-7,9-10,14,20H,4-5,8H2,1-3H3 |
| InChIKey | BUMMAJOOBXIOFY-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.24 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |