C15H17BrF3N — CID 105037112
1-[2-bromo-5-(trifluoromethyl)phenyl]-N-ethylhex-4-yn-1-amine (PubChem CID 105037112) has the molecular formula C15H17BrF3N and a molecular weight of 348.21 g/mol. Its IUPAC name is 1-[2-bromo-5-(trifluoromethyl)phenyl]-N-ethylhex-4-yn-1-amine.
| Compound Name | 1-[2-bromo-5-(trifluoromethyl)phenyl]-N-ethylhex-4-yn-1-amine |
|---|---|
| PubChem CID | 105037112 |
| Molecular Formula | C15H17BrF3N |
| Molecular Weight | 348.21 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 1-[2-bromo-5-(trifluoromethyl)phenyl]-N-ethylhex-4-yn-1-amine |
| SMILES | CC#CCCC(NCC)c1cc(C(F)(F)F)ccc1Br |
| InChI | InChI=1S/C15H17BrF3N/c1-3-5-6-7-14(20-4-2)12-10-11(15(17,18)19)8-9-13(12)16/h8-10,14,20H,4,6-7H2,1-2H3 |
| InChIKey | VKQXJPWMMKIDNK-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.21 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|