C14H17Br2N — CID 105037425
1-(2,5-dibromophenyl)-N-ethylhex-4-yn-1-amine (PubChem CID 105037425) has the molecular formula C14H17Br2N and a molecular weight of 359.11 g/mol. Its IUPAC name is 1-(2,5-dibromophenyl)-N-ethylhex-4-yn-1-amine.
| Compound Name | 1-(2,5-dibromophenyl)-N-ethylhex-4-yn-1-amine |
|---|---|
| PubChem CID | 105037425 |
| Molecular Formula | C14H17Br2N |
| Molecular Weight | 359.11 g/mol |
| Exact Mass | 356.97 |
| IUPAC Name | 1-(2,5-dibromophenyl)-N-ethylhex-4-yn-1-amine |
| SMILES | CC#CCCC(NCC)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C14H17Br2N/c1-3-5-6-7-14(17-4-2)12-10-11(15)8-9-13(12)16/h8-10,14,17H,4,6-7H2,1-2H3 |
| InChIKey | YFSAFDJWAJLKHV-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.11 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|