C12H11BrF3N — CID 104995389
1-[2-bromo-5-(trifluoromethyl)phenyl]-N-ethylprop-2-yn-1-amine (PubChem CID 104995389) has the molecular formula C12H11BrF3N and a molecular weight of 306.13 g/mol. Its IUPAC name is 1-[2-bromo-5-(trifluoromethyl)phenyl]-N-ethylprop-2-yn-1-amine.
| Compound Name | 1-[2-bromo-5-(trifluoromethyl)phenyl]-N-ethylprop-2-yn-1-amine |
|---|---|
| PubChem CID | 104995389 |
| Molecular Formula | C12H11BrF3N |
| Molecular Weight | 306.13 g/mol |
| Exact Mass | 305.00 |
| IUPAC Name | 1-[2-bromo-5-(trifluoromethyl)phenyl]-N-ethylprop-2-yn-1-amine |
| SMILES | C#CC(NCC)c1cc(C(F)(F)F)ccc1Br |
| InChI | InChI=1S/C12H11BrF3N/c1-3-11(17-4-2)9-7-8(12(14,15)16)5-6-10(9)13/h1,5-7,11,17H,4H2,2H3 |
| InChIKey | SYZCIZFHOWEFIQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.13 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|