C11H11BrFN — CID 104995612
1-(2-bromo-5-fluorophenyl)-N-ethylprop-2-yn-1-amine (PubChem CID 104995612) has the molecular formula C11H11BrFN and a molecular weight of 256.12 g/mol. Its IUPAC name is 1-(2-bromo-5-fluorophenyl)-N-ethylprop-2-yn-1-amine.
| Compound Name | 1-(2-bromo-5-fluorophenyl)-N-ethylprop-2-yn-1-amine |
|---|---|
| PubChem CID | 104995612 |
| Molecular Formula | C11H11BrFN |
| Molecular Weight | 256.12 g/mol |
| Exact Mass | 255.01 |
| IUPAC Name | 1-(2-bromo-5-fluorophenyl)-N-ethylprop-2-yn-1-amine |
| SMILES | C#CC(NCC)c1cc(F)ccc1Br |
| InChI | InChI=1S/C11H11BrFN/c1-3-11(14-4-2)9-7-8(13)5-6-10(9)12/h1,5-7,11,14H,4H2,2H3 |
| InChIKey | ABWUUYHHIUXUQK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.12 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|