C13H17BrF3N — CID 115832928
1-[2-bromo-5-(trifluoromethyl)phenyl]-N-methylpentan-1-amine (PubChem CID 115832928) has the molecular formula C13H17BrF3N and a molecular weight of 324.18 g/mol. Its IUPAC name is 1-[2-bromo-5-(trifluoromethyl)phenyl]-N-methylpentan-1-amine.
| Compound Name | 1-[2-bromo-5-(trifluoromethyl)phenyl]-N-methylpentan-1-amine |
|---|---|
| PubChem CID | 115832928 |
| Molecular Formula | C13H17BrF3N |
| Molecular Weight | 324.18 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 1-[2-bromo-5-(trifluoromethyl)phenyl]-N-methylpentan-1-amine |
| SMILES | CCCCC(NC)c1cc(C(F)(F)F)ccc1Br |
| InChI | InChI=1S/C13H17BrF3N/c1-3-4-5-12(18-2)10-8-9(13(15,16)17)6-7-11(10)14/h6-8,12,18H,3-5H2,1-2H3 |
| InChIKey | CXJFSXZDOOXVNY-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.18 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |