C14H12Br2F3NS — CID 115849141
2-(3-bromothiophen-2-yl)-1-[2-bromo-5-(trifluoromethyl)phenyl]-N-methylethanamine (PubChem CID 115849141) has the molecular formula C14H12Br2F3NS and a molecular weight of 443.13 g/mol. Its IUPAC name is 2-(3-bromothiophen-2-yl)-1-[2-bromo-5-(trifluoromethyl)phenyl]-N-methylethanamine.
| Compound Name | 2-(3-bromothiophen-2-yl)-1-[2-bromo-5-(trifluoromethyl)phenyl]-N-methylethanamine |
|---|---|
| PubChem CID | 115849141 |
| Molecular Formula | C14H12Br2F3NS |
| Molecular Weight | 443.13 g/mol |
| Exact Mass | 440.90 |
| IUPAC Name | 2-(3-bromothiophen-2-yl)-1-[2-bromo-5-(trifluoromethyl)phenyl]-N-methylethanamine |
| SMILES | CNC(Cc1sccc1Br)c1cc(C(F)(F)F)ccc1Br |
| InChI | InChI=1S/C14H12Br2F3NS/c1-20-12(7-13-11(16)4-5-21-13)9-6-8(14(17,18)19)2-3-10(9)15/h2-6,12,20H,7H2,1H3 |
| InChIKey | HQAACASMBUPSCS-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.13 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |