C12H14BrNOS — CID 104790070
2-(3-bromothiophen-2-yl)-N-methyl-1-(2-methylfuran-3-yl)ethanamine (PubChem CID 104790070) has the molecular formula C12H14BrNOS and a molecular weight of 300.22 g/mol. Its IUPAC name is 2-(3-bromothiophen-2-yl)-N-methyl-1-(2-methylfuran-3-yl)ethanamine.
| Compound Name | 2-(3-bromothiophen-2-yl)-N-methyl-1-(2-methylfuran-3-yl)ethanamine |
|---|---|
| PubChem CID | 104790070 |
| Molecular Formula | C12H14BrNOS |
| Molecular Weight | 300.22 g/mol |
| Exact Mass | 299.00 |
| IUPAC Name | 2-(3-bromothiophen-2-yl)-N-methyl-1-(2-methylfuran-3-yl)ethanamine |
| SMILES | CNC(Cc1sccc1Br)c1ccoc1C |
| InChI | InChI=1S/C12H14BrNOS/c1-8-9(3-5-15-8)11(14-2)7-12-10(13)4-6-16-12/h3-6,11,14H,7H2,1-2H3 |
| InChIKey | KVKHRYDXZYANSP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.22 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |