C12H13F6N — CID 139966105
1-[2,3-bis(trifluoromethyl)phenyl]-N-methylpropan-1-amine (PubChem CID 139966105) has the molecular formula C12H13F6N and a molecular weight of 285.23 g/mol. Its IUPAC name is 1-[2,3-bis(trifluoromethyl)phenyl]-N-methylpropan-1-amine.
| Compound Name | 1-[2,3-bis(trifluoromethyl)phenyl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 139966105 |
| Molecular Formula | C12H13F6N |
| Molecular Weight | 285.23 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 1-[2,3-bis(trifluoromethyl)phenyl]-N-methylpropan-1-amine |
| SMILES | CCC(NC)c1cccc(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C12H13F6N/c1-3-9(19-2)7-5-4-6-8(11(13,14)15)10(7)12(16,17)18/h4-6,9,19H,3H2,1-2H3 |
| InChIKey | MXSGUWGFUKBLGC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.23 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |