C11H10F6O — CID 139965745
1-[2,3-bis(trifluoromethyl)phenyl]propan-1-ol (PubChem CID 139965745) has the molecular formula C11H10F6O and a molecular weight of 272.19 g/mol. Its IUPAC name is 1-[2,3-bis(trifluoromethyl)phenyl]propan-1-ol.
| Compound Name | 1-[2,3-bis(trifluoromethyl)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 139965745 |
| Molecular Formula | C11H10F6O |
| Molecular Weight | 272.19 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 1-[2,3-bis(trifluoromethyl)phenyl]propan-1-ol |
| SMILES | CCC(O)c1cccc(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C11H10F6O/c1-2-8(18)6-4-3-5-7(10(12,13)14)9(6)11(15,16)17/h3-5,8,18H,2H2,1H3 |
| InChIKey | IIVGXCMUCPKZGE-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.19 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |