C13H12F9NO3 — CID 139965798
N-methyl-1-[2,3,6-tris(trifluoromethoxy)phenyl]propan-1-amine (PubChem CID 139965798) has the molecular formula C13H12F9NO3 and a molecular weight of 401.23 g/mol. Its IUPAC name is N-methyl-1-[2,3,6-tris(trifluoromethoxy)phenyl]propan-1-amine.
| Compound Name | N-methyl-1-[2,3,6-tris(trifluoromethoxy)phenyl]propan-1-amine |
|---|---|
| PubChem CID | 139965798 |
| Molecular Formula | C13H12F9NO3 |
| Molecular Weight | 401.23 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | N-methyl-1-[2,3,6-tris(trifluoromethoxy)phenyl]propan-1-amine |
| SMILES | CCC(NC)c1c(OC(F)(F)F)ccc(OC(F)(F)F)c1OC(F)(F)F |
| InChI | InChI=1S/C13H12F9NO3/c1-3-6(23-2)9-7(24-11(14,15)16)4-5-8(25-12(17,18)19)10(9)26-13(20,21)22/h4-6,23H,3H2,1-2H3 |
| InChIKey | UVLBQAROWYIVJL-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.23 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |