C12H10F9NO3 — CID 139966111
N-methyl-1-[2,3,6-tris(trifluoromethoxy)phenyl]ethanamine (PubChem CID 139966111) has the molecular formula C12H10F9NO3 and a molecular weight of 387.20 g/mol. Its IUPAC name is N-methyl-1-[2,3,6-tris(trifluoromethoxy)phenyl]ethanamine.
| Compound Name | N-methyl-1-[2,3,6-tris(trifluoromethoxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 139966111 |
| Molecular Formula | C12H10F9NO3 |
| Molecular Weight | 387.20 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | N-methyl-1-[2,3,6-tris(trifluoromethoxy)phenyl]ethanamine |
| SMILES | CNC(C)c1c(OC(F)(F)F)ccc(OC(F)(F)F)c1OC(F)(F)F |
| InChI | InChI=1S/C12H10F9NO3/c1-5(22-2)8-6(23-10(13,14)15)3-4-7(24-11(16,17)18)9(8)25-12(19,20)21/h3-5,22H,1-2H3 |
| InChIKey | VTRWKOCXOXAUNX-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.20 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |