C11H8F9NO3 — CID 139966129
1-[2,3,4-tris(trifluoromethoxy)phenyl]ethanamine (PubChem CID 139966129) has the molecular formula C11H8F9NO3 and a molecular weight of 373.17 g/mol. Its IUPAC name is 1-[2,3,4-tris(trifluoromethoxy)phenyl]ethanamine.
| Compound Name | 1-[2,3,4-tris(trifluoromethoxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 139966129 |
| Molecular Formula | C11H8F9NO3 |
| Molecular Weight | 373.17 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | 1-[2,3,4-tris(trifluoromethoxy)phenyl]ethanamine |
| SMILES | CC(N)c1ccc(OC(F)(F)F)c(OC(F)(F)F)c1OC(F)(F)F |
| InChI | InChI=1S/C11H8F9NO3/c1-4(21)5-2-3-6(22-9(12,13)14)8(24-11(18,19)20)7(5)23-10(15,16)17/h2-4H,21H2,1H3 |
| InChIKey | BCLORFLGHPHWPG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.17 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |