C14H11F12NO4 — CID 139966101
2-methyl-1-[2,3,4,5-tetrakis(trifluoromethoxy)phenyl]propan-1-amine (PubChem CID 139966101) has the molecular formula C14H11F12NO4 and a molecular weight of 485.22 g/mol. Its IUPAC name is 2-methyl-1-[2,3,4,5-tetrakis(trifluoromethoxy)phenyl]propan-1-amine.
| Compound Name | 2-methyl-1-[2,3,4,5-tetrakis(trifluoromethoxy)phenyl]propan-1-amine |
|---|---|
| PubChem CID | 139966101 |
| Molecular Formula | C14H11F12NO4 |
| Molecular Weight | 485.22 g/mol |
| Exact Mass | 485.05 |
| IUPAC Name | 2-methyl-1-[2,3,4,5-tetrakis(trifluoromethoxy)phenyl]propan-1-amine |
| SMILES | CC(C)C(N)c1cc(OC(F)(F)F)c(OC(F)(F)F)c(OC(F)(F)F)c1OC(F)(F)F |
| InChI | InChI=1S/C14H11F12NO4/c1-4(2)7(27)5-3-6(28-11(15,16)17)9(30-13(21,22)23)10(31-14(24,25)26)8(5)29-12(18,19)20/h3-4,7H,27H2,1-2H3 |
| InChIKey | RPAXSFMINWQSJY-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.22 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |