C14H9F12NO4 — CID 139966040
cyclopropyl-[2,3,5,6-tetrakis(trifluoromethoxy)phenyl]methanamine (PubChem CID 139966040) has the molecular formula C14H9F12NO4 and a molecular weight of 483.21 g/mol. Its IUPAC name is cyclopropyl-[2,3,5,6-tetrakis(trifluoromethoxy)phenyl]methanamine.
| Compound Name | cyclopropyl-[2,3,5,6-tetrakis(trifluoromethoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 139966040 |
| Molecular Formula | C14H9F12NO4 |
| Molecular Weight | 483.21 g/mol |
| Exact Mass | 483.03 |
| IUPAC Name | cyclopropyl-[2,3,5,6-tetrakis(trifluoromethoxy)phenyl]methanamine |
| SMILES | NC(c1c(OC(F)(F)F)c(OC(F)(F)F)cc(OC(F)(F)F)c1OC(F)(F)F)C1CC1 |
| InChI | InChI=1S/C14H9F12NO4/c15-11(16,17)28-5-3-6(29-12(18,19)20)10(31-14(24,25)26)7(8(27)4-1-2-4)9(5)30-13(21,22)23/h3-4,8H,1-2,27H2 |
| InChIKey | PQBLNXRDZIRGPL-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.21 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |