C13H15F4NO — CID 171227912
(S)-cyclopentyl-[3-fluoro-4-(trifluoromethoxy)phenyl]methanamine (PubChem CID 171227912) has the molecular formula C13H15F4NO and a molecular weight of 277.26 g/mol. Its IUPAC name is (S)-cyclopentyl-[3-fluoro-4-(trifluoromethoxy)phenyl]methanamine.
| Compound Name | (S)-cyclopentyl-[3-fluoro-4-(trifluoromethoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 171227912 |
| Molecular Formula | C13H15F4NO |
| Molecular Weight | 277.26 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | (S)-cyclopentyl-[3-fluoro-4-(trifluoromethoxy)phenyl]methanamine |
| SMILES | N[C@H](c1ccc(OC(F)(F)F)c(F)c1)C1CCCC1 |
| InChI | InChI=1S/C13H15F4NO/c14-10-7-9(12(18)8-3-1-2-4-8)5-6-11(10)19-13(15,16)17/h5-8,12H,1-4,18H2/t12-/m0/s1 |
| InChIKey | WITZLCLROCHBOM-LBPRGKRZSA-N |
| XLogP | 3.91 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.26 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |