C14H14F4O — CID 118196153
4-(dicyclopropylmethyl)-2-fluoro-1-(trifluoromethoxy)benzene (PubChem CID 118196153) has the molecular formula C14H14F4O and a molecular weight of 274.26 g/mol. Its IUPAC name is 4-(dicyclopropylmethyl)-2-fluoro-1-(trifluoromethoxy)benzene.
| Compound Name | 4-(dicyclopropylmethyl)-2-fluoro-1-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 118196153 |
| Molecular Formula | C14H14F4O |
| Molecular Weight | 274.26 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 4-(dicyclopropylmethyl)-2-fluoro-1-(trifluoromethoxy)benzene |
| SMILES | Fc1cc(C(C2CC2)C2CC2)ccc1OC(F)(F)F |
| InChI | InChI=1S/C14H14F4O/c15-11-7-10(5-6-12(11)19-14(16,17)18)13(8-1-2-8)9-3-4-9/h5-9,13H,1-4H2 |
| InChIKey | PIRAVPGIOMECKK-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.26 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |