C13H10F7N3O — CID 166045522
4-[azido-[3-(trifluoromethyl)cyclobutyl]methyl]-2-fluoro-1-(trifluoromethoxy)benzene (PubChem CID 166045522) has the molecular formula C13H10F7N3O and a molecular weight of 357.23 g/mol. Its IUPAC name is 4-[azido-[3-(trifluoromethyl)cyclobutyl]methyl]-2-fluoro-1-(trifluoromethoxy)benzene.
| Compound Name | 4-[azido-[3-(trifluoromethyl)cyclobutyl]methyl]-2-fluoro-1-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 166045522 |
| Molecular Formula | C13H10F7N3O |
| Molecular Weight | 357.23 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 4-[azido-[3-(trifluoromethyl)cyclobutyl]methyl]-2-fluoro-1-(trifluoromethoxy)benzene |
| SMILES | [N-]=[N+]=NC(c1ccc(OC(F)(F)F)c(F)c1)C1CC(C(F)(F)F)C1 |
| InChI | InChI=1S/C13H10F7N3O/c14-9-5-6(1-2-10(9)24-13(18,19)20)11(22-23-21)7-3-8(4-7)12(15,16)17/h1-2,5,7-8,11H,3-4H2 |
| InChIKey | KHMDWHHTUQAMPA-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.23 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|