C16H23F3O — CID 134237189
1,2,3-tri(propan-2-yl)-4-(trifluoromethoxy)benzene (PubChem CID 134237189) has the molecular formula C16H23F3O and a molecular weight of 288.35 g/mol. Its IUPAC name is 1,2,3-tri(propan-2-yl)-4-(trifluoromethoxy)benzene.
| Compound Name | 1,2,3-tri(propan-2-yl)-4-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 134237189 |
| Molecular Formula | C16H23F3O |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 1,2,3-tri(propan-2-yl)-4-(trifluoromethoxy)benzene |
| SMILES | CC(C)c1ccc(OC(F)(F)F)c(C(C)C)c1C(C)C |
| InChI | InChI=1S/C16H23F3O/c1-9(2)12-7-8-13(20-16(17,18)19)15(11(5)6)14(12)10(3)4/h7-11H,1-6H3 |
| InChIKey | RHRPVSGMBNLNMA-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |