C13H15F6NO2 — CID 139965943
1-[2,6-bis(trifluoromethoxy)phenyl]-N,2-dimethylpropan-1-amine (PubChem CID 139965943) has the molecular formula C13H15F6NO2 and a molecular weight of 331.26 g/mol. Its IUPAC name is 1-[2,6-bis(trifluoromethoxy)phenyl]-N,2-dimethylpropan-1-amine.
| Compound Name | 1-[2,6-bis(trifluoromethoxy)phenyl]-N,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 139965943 |
| Molecular Formula | C13H15F6NO2 |
| Molecular Weight | 331.26 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 1-[2,6-bis(trifluoromethoxy)phenyl]-N,2-dimethylpropan-1-amine |
| SMILES | CNC(c1c(OC(F)(F)F)cccc1OC(F)(F)F)C(C)C |
| InChI | InChI=1S/C13H15F6NO2/c1-7(2)11(20-3)10-8(21-12(14,15)16)5-4-6-9(10)22-13(17,18)19/h4-7,11,20H,1-3H3 |
| InChIKey | YTJNCBFJJTWENJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.26 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |