C12H6F6O2 — CID 118813409
1,8-bis(trifluoromethoxy)naphthalene (PubChem CID 118813409) has the molecular formula C12H6F6O2 and a molecular weight of 296.17 g/mol. Its IUPAC name is 1,8-bis(trifluoromethoxy)naphthalene.
| Compound Name | 1,8-bis(trifluoromethoxy)naphthalene |
|---|---|
| PubChem CID | 118813409 |
| Molecular Formula | C12H6F6O2 |
| Molecular Weight | 296.17 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | 1,8-bis(trifluoromethoxy)naphthalene |
| SMILES | FC(F)(F)Oc1cccc2cccc(OC(F)(F)F)c12 |
| InChI | InChI=1S/C12H6F6O2/c13-11(14,15)19-8-5-1-3-7-4-2-6-9(10(7)8)20-12(16,17)18/h1-6H |
| InChIKey | FBTJLAFRPQVHAW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.17 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |