C14H20N2 — CID 177223056
4-(aminomethyl)-2,6-dipropylbenzonitrile (PubChem CID 177223056) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 4-(aminomethyl)-2,6-dipropylbenzonitrile.
| Compound Name | 4-(aminomethyl)-2,6-dipropylbenzonitrile |
|---|---|
| PubChem CID | 177223056 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 4-(aminomethyl)-2,6-dipropylbenzonitrile |
| SMILES | CCCc1cc(CN)cc(CCC)c1C#N |
| InChI | InChI=1S/C14H20N2/c1-3-5-12-7-11(9-15)8-13(6-4-2)14(12)10-16/h7-8H,3-6,9,15H2,1-2H3 |
| InChIKey | ZCDGFXMNLPFIBO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |