About diiodovanadium;2,6-dimethyl-4-pentylbenzonitrile
diiodovanadium;2,6-dimethyl-4-pentylbenzonitrile (PubChem CID 160582477) has the molecular formula C14H19I2NV
and a molecular weight of 506.07 g/mol. Its IUPAC name is diiodovanadium;2,6-dimethyl-4-pentylbenzonitrile.
Molecular Properties
| Compound Name | diiodovanadium;2,6-dimethyl-4-pentylbenzonitrile |
| PubChem CID | 160582477 |
| Molecular Formula | C14H19I2NV |
| Molecular Weight | 506.07 g/mol |
| Exact Mass | 505.90 |
| IUPAC Name | diiodovanadium;2,6-dimethyl-4-pentylbenzonitrile |
| SMILES | CCCCCc1cc(C)c(C#N)c(C)c1.I[V]I |
| InChI | InChI=1S/C14H19N.2HI.V/c1-4-5-6-7-13-8-11(2)14(10-15)12(3)9-13;;;/h8-9H,4-7H2,1-3H3;2*1H;/q;;;+2/p-2 |
| InChIKey | RBYQVQIUHJJYMS-UHFFFAOYSA-L |
| XLogP | 5.68 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 506.07 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze diiodovanadium;2,6-dimethyl-4-pentylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diiodovanadium;2,6-dimethyl-4-pentylbenzonitrile?
The IUPAC name of diiodovanadium;2,6-dimethyl-4-pentylbenzonitrile (CID 160582477) is diiodovanadium;2,6-dimethyl-4-pentylbenzonitrile.
What is the SMILES notation for diiodovanadium;2,6-dimethyl-4-pentylbenzonitrile?
The canonical SMILES for diiodovanadium;2,6-dimethyl-4-pentylbenzonitrile is CCCCCc1cc(C)c(C#N)c(C)c1.I[V]I.
What is the InChIKey of diiodovanadium;2,6-dimethyl-4-pentylbenzonitrile?
The InChIKey is RBYQVQIUHJJYMS-UHFFFAOYSA-L. The full InChI is InChI=1S/C14H19N.2HI.V/c1-4-5-6-7-13-8-11(2)14(10-15)12(3)9-13;;;/h8-9H,4-7H2,1-3H3;2*1H;/q;;;+2/p-2.
What are the key properties of diiodovanadium;2,6-dimethyl-4-pentylbenzonitrile?
diiodovanadium;2,6-dimethyl-4-pentylbenzonitrile has a molecular weight of 506.07 g/mol, XLogP of 5.68, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for diiodovanadium;2,6-dimethyl-4-pentylbenzonitrile is sourced from PubChem (CID 160582477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).