C7HF5N2 — CID 141497615
2,6-difluoro-4-(trifluoromethyl)pyridine-3-carbonitrile (PubChem CID 141497615) has the molecular formula C7HF5N2 and a molecular weight of 208.09 g/mol. Its IUPAC name is 2,6-difluoro-4-(trifluoromethyl)pyridine-3-carbonitrile.
| Compound Name | 2,6-difluoro-4-(trifluoromethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 141497615 |
| Molecular Formula | C7HF5N2 |
| Molecular Weight | 208.09 g/mol |
| Exact Mass | 208.01 |
| IUPAC Name | 2,6-difluoro-4-(trifluoromethyl)pyridine-3-carbonitrile |
| SMILES | N#Cc1c(C(F)(F)F)cc(F)nc1F |
| InChI | InChI=1S/C7HF5N2/c8-5-1-4(7(10,11)12)3(2-13)6(9)14-5/h1H |
| InChIKey | RJDPUQGGJCGUJJ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.09 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|