C8H4F3N2S- — CID 7063940
3-cyano-6-methyl-4-(trifluoromethyl)pyridine-2-thiolate (PubChem CID 7063940) has the molecular formula C8H4F3N2S- and a molecular weight of 217.19 g/mol. Its IUPAC name is 3-cyano-6-methyl-4-(trifluoromethyl)pyridine-2-thiolate.
| Compound Name | 3-cyano-6-methyl-4-(trifluoromethyl)pyridine-2-thiolate |
|---|---|
| PubChem CID | 7063940 |
| Molecular Formula | C8H4F3N2S- |
| Molecular Weight | 217.19 g/mol |
| Exact Mass | 217.01 |
| IUPAC Name | 3-cyano-6-methyl-4-(trifluoromethyl)pyridine-2-thiolate |
| SMILES | Cc1cc(C(F)(F)F)c(C#N)c([S-])n1 |
| InChI | InChI=1S/C8H5F3N2S/c1-4-2-6(8(9,10)11)5(3-12)7(14)13-4/h2H,1H3,(H,13,14)/p-1 |
| InChIKey | SNXNHTJMLREHDW-UHFFFAOYSA-M |
| XLogP | 2.19 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.19 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|