C16H14Cl2N4S2Sn — CID 15978262
bis(3-cyano-4,6-dimethylpyridine-2-thiolate);dichlorotin(2+) (PubChem CID 15978262) has the molecular formula C16H14Cl2N4S2Sn and a molecular weight of 516.07 g/mol. Its IUPAC name is bis(3-cyano-4,6-dimethylpyridine-2-thiolate);dichlorotin(2+).
| Compound Name | bis(3-cyano-4,6-dimethylpyridine-2-thiolate);dichlorotin(2+) |
|---|---|
| PubChem CID | 15978262 |
| Molecular Formula | C16H14Cl2N4S2Sn |
| Molecular Weight | 516.07 g/mol |
| Exact Mass | 515.91 |
| IUPAC Name | bis(3-cyano-4,6-dimethylpyridine-2-thiolate);dichlorotin(2+) |
| SMILES | Cc1cc(C)c(C#N)c([S-])n1.Cc1cc(C)c(C#N)c([S-])n1.Cl[Sn+2]Cl |
| InChI | InChI=1S/2C8H8N2S.2ClH.Sn/c2*1-5-3-6(2)10-8(11)7(5)4-9;;;/h2*3H,1-2H3,(H,10,11);2*1H;/q;;;;+4/p-4 |
| InChIKey | HHMMDDVVTHFXFN-UHFFFAOYSA-J |
| XLogP | 3.95 |
| TPSA | 73.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.07 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|