C30H4F8N8 — CID 169121689
(3Z,6Z)-3,6-bis[cyano-[3,4-dicyano-5-(trifluoromethyl)phenyl]methylidene]-4,5-difluorocyclohexa-1,4-diene-1,2-dicarbonitrile (PubChem CID 169121689) has the molecular formula C30H4F8N8 and a molecular weight of 628.40 g/mol. Its IUPAC name is (3Z,6Z)-3,6-bis[cyano-[3,4-dicyano-5-(trifluoromethyl)phenyl]methylidene]-4,5-difluorocyclohexa-1,4-diene-1,2-dicarbonitrile.
| Compound Name | (3Z,6Z)-3,6-bis[cyano-[3,4-dicyano-5-(trifluoromethyl)phenyl]methylidene]-4,5-difluorocyclohexa-1,4-diene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 169121689 |
| Molecular Formula | C30H4F8N8 |
| Molecular Weight | 628.40 g/mol |
| Exact Mass | 628.04 |
| IUPAC Name | (3Z,6Z)-3,6-bis[cyano-[3,4-dicyano-5-(trifluoromethyl)phenyl]methylidene]-4,5-difluorocyclohexa-1,4-diene-1,2-dicarbonitrile |
| SMILES | N#C/C(c1cc(C#N)c(C#N)c(C(F)(F)F)c1)=c1\c(F)c(F)/c(=C(\C#N)c2cc(C#N)c(C#N)c(C(F)(F)F)c2)c(C#N)c1C#N |
| InChI | InChI=1S/C30H4F8N8/c31-27-25(19(9-43)13-1-15(5-39)17(7-41)23(3-13)29(33,34)35)21(11-45)22(12-46)26(28(27)32)20(10-44)14-2-16(6-40)18(8-42)24(4-14)30(36,37)38/h1-4H/b25-19+,26-20+ |
| InChIKey | UGFBQYNJNKACHK-FQHZWJPGSA-N |
| XLogP | 4.68 |
| TPSA | 190.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.40 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |