C25HF9N8 — CID 176690118
3-[cyano-[4-cyano-2,3,5-tris(trifluoromethyl)phenyl]methylidene]-6-(dicyanomethylidene)cyclohexa-1,4-diene-1,2,4,5-tetracarbonitrile (PubChem CID 176690118) has the molecular formula C25HF9N8 and a molecular weight of 584.32 g/mol. Its IUPAC name is 3-[cyano-[4-cyano-2,3,5-tris(trifluoromethyl)phenyl]methylidene]-6-(dicyanomethylidene)cyclohexa-1,4-diene-1,2,4,5-tetracarbonitrile.
| Compound Name | 3-[cyano-[4-cyano-2,3,5-tris(trifluoromethyl)phenyl]methylidene]-6-(dicyanomethylidene)cyclohexa-1,4-diene-1,2,4,5-tetracarbonitrile |
|---|---|
| PubChem CID | 176690118 |
| Molecular Formula | C25HF9N8 |
| Molecular Weight | 584.32 g/mol |
| Exact Mass | 584.02 |
| IUPAC Name | 3-[cyano-[4-cyano-2,3,5-tris(trifluoromethyl)phenyl]methylidene]-6-(dicyanomethylidene)cyclohexa-1,4-diene-1,2,4,5-tetracarbonitrile |
| SMILES | N#CC(C#N)=c1c(C#N)c(C#N)c(=C(C#N)c2cc(C(F)(F)F)c(C#N)c(C(F)(F)F)c2C(F)(F)F)c(C#N)c1C#N |
| InChI | InChI=1S/C25HF9N8/c26-23(27,28)18-1-11(21(24(29,30)31)22(17(18)9-42)25(32,33)34)12(4-37)20-15(7-40)13(5-38)19(10(2-35)3-36)14(6-39)16(20)8-41/h1H |
| InChIKey | KDUNYLJEMSSKNM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 190.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.32 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |